Difference between revisions of "CPD-465"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == * smiles: ** CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=...") |
|||
Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == | ||
* smiles: | * smiles: | ||
− | ** CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C) | + | ** CC(=CCCC(=CCCC(=CC1(C(C)(CCC=C(CCC=C(C)C)C)C1COP(OP([O-])([O-])=O)([O-])=O))C)C)C |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* molecular weight: | * molecular weight: | ||
** 583.66 | ** 583.66 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ATZKAUGGNMSCCY-QLYDTTAWSA-K | ||
+ | * common name: | ||
+ | ** presqualene diphosphate | ||
* Synonym(s): | * Synonym(s): | ||
Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* METABOLIGHTS : MTBLC57310 | * METABOLIGHTS : MTBLC57310 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244634 25244634] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244634 25244634] | ||
− | {{#set: smiles=CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C) | + | * HMDB : HMDB01278 |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57310 57310] | |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03428 C03428] | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CC1(C(C)(CCC=C(CCC=C(C)C)C)C1COP(OP([O-])([O-])=O)([O-])=O))C)C)C}} | ||
{{#set: molecular weight=583.66 }} | {{#set: molecular weight=583.66 }} | ||
+ | {{#set: inchi key=InChIKey=ATZKAUGGNMSCCY-QLYDTTAWSA-K}} | ||
+ | {{#set: common name=presqualene diphosphate}} | ||
{{#set: consumed by=RXN-13724|RXN66-281}} | {{#set: consumed by=RXN-13724|RXN66-281}} | ||
{{#set: produced by=RXN-12263}} | {{#set: produced by=RXN-12263}} |
Latest revision as of 14:01, 10 January 2019
Contents
Metabolite CPD-465
- smiles:
- CC(=CCCC(=CCCC(=CC1(C(C)(CCC=C(CCC=C(C)C)C)C1COP(OP([O-])([O-])=O)([O-])=O))C)C)C
- molecular weight:
- 583.66
- inchi key:
- InChIKey=ATZKAUGGNMSCCY-QLYDTTAWSA-K
- common name:
- presqualene diphosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CC1(C(C)(CCC=C(CCC=C(C)C)C)C1COP(OP([O-])([O-])=O)([O-])=O))C)C)C" cannot be used as a page name in this wiki.