Difference between revisions of "CPD-9873"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] == | ||
* smiles: | * smiles: | ||
| − | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C( | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(O)C(OC)=C(O)C(O)=C(C)1) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
** 851.347 | ** 851.347 | ||
| + | * inchi key: | ||
| + | ** InChIKey=VLMQNHNMQVLPQI-AVRCVIBKSA-N | ||
| + | * common name: | ||
| + | ** 3-demethylubiquinol-10 | ||
* Synonym(s): | * Synonym(s): | ||
| Line 14: | Line 14: | ||
* [[RXN-9237]] | * [[RXN-9237]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64182 64182] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64182 64182] | ||
| − | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C( | + | * PUBCHEM: |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927876 56927876] | |
| − | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(O)C(OC)=C(O)C(O)=C(C)1)}} | |
{{#set: molecular weight=851.347 }} | {{#set: molecular weight=851.347 }} | ||
| + | {{#set: inchi key=InChIKey=VLMQNHNMQVLPQI-AVRCVIBKSA-N}} | ||
| + | {{#set: common name=3-demethylubiquinol-10}} | ||
{{#set: consumed by=RXN-9237}} | {{#set: consumed by=RXN-9237}} | ||
| − | |||
Latest revision as of 14:01, 10 January 2019
Contents
Metabolite CPD-9873
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(O)C(OC)=C(O)C(O)=C(C)1)
- molecular weight:
- 851.347
- inchi key:
- InChIKey=VLMQNHNMQVLPQI-AVRCVIBKSA-N
- common name:
- 3-demethylubiquinol-10
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
