Difference between revisions of "CPD0-2030"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * common name: **...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O | ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 258.144 | ** 258.144 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M | ||
| + | * common name: | ||
| + | ** glycerophosphoserine | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64765 64765] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339260 57339260] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339260 57339260] | ||
| − | |||
| − | |||
* BIGG : g3ps | * BIGG : g3ps | ||
{{#set: smiles=C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O}} | {{#set: smiles=C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=258.144 }} | {{#set: molecular weight=258.144 }} | ||
| + | {{#set: inchi key=InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M}} | ||
| + | {{#set: common name=glycerophosphoserine}} | ||
{{#set: consumed by=RXN-14136}} | {{#set: consumed by=RXN-14136}} | ||
Latest revision as of 13:05, 10 January 2019
Contents
Metabolite CPD0-2030
- smiles:
- C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
- molecular weight:
- 258.144
- inchi key:
- InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
- common name:
- glycerophosphoserine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O" cannot be used as a page name in this wiki.
