Difference between revisions of "CPD-13717"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * common name: *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] | ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 269.159 | ** 269.159 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N | ||
| + | * common name: | ||
| + | ** L-selenocystathionine | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-15137]] | * [[RXN-15137]] | ||
| + | * [[RXN-12729]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
* [[ACHMSSELCYSL]] | * [[ACHMSSELCYSL]] | ||
| + | * [[SUCHMSSELCYSLh]] | ||
* [[ACHMSSELCYSLh]] | * [[ACHMSSELCYSLh]] | ||
* [[SUCHMSSELCYSL]] | * [[SUCHMSSELCYSL]] | ||
| + | * [[RXN-12728]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62226 62226] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921580 52921580] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921580 52921580] | ||
* HMDB : HMDB06343 | * HMDB : HMDB06343 | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05699 C05699] | ** [http://www.genome.jp/dbget-bin/www_bget?C05699 C05699] | ||
{{#set: smiles=C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]}} | {{#set: smiles=C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=269.159 }} | {{#set: molecular weight=269.159 }} | ||
| − | {{#set: consumed by=RXN- | + | {{#set: inchi key=InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N}} |
| − | {{#set: produced by= | + | {{#set: common name=L-selenocystathionine}} |
| + | {{#set: consumed by=RXN-15137|RXN-12729}} | ||
| + | {{#set: produced by=ACHMSSELCYSL|SUCHMSSELCYSLh|ACHMSSELCYSLh|SUCHMSSELCYSL|RXN-12728}} | ||
Latest revision as of 13:06, 10 January 2019
Contents
Metabolite CPD-13717
- smiles:
- C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]
- molecular weight:
- 269.159
- inchi key:
- InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N
- common name:
- L-selenocystathionine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-" cannot be used as a page name in this wiki.
