Difference between revisions of "CPD-13578"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13578 CPD-13578] == * smiles: ** CC1(=NC(=C(C[N+])C=N1)N) * common name: ** aminomethylpyri...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC1(=NC(=C(C[N+])C=N1)N) | ** CC1(=NC(=C(C[N+])C=N1)N) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 139.18 | ** 139.18 | ||
| + | * inchi key: | ||
| + | ** InChIKey=OZOHTVFCSKFMLL-UHFFFAOYSA-O | ||
| + | * common name: | ||
| + | ** aminomethylpyrimidine | ||
* Synonym(s): | * Synonym(s): | ||
** 4-amino-5-aminomethyl-2-methylpyrimidine | ** 4-amino-5-aminomethyl-2-methylpyrimidine | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63416 63416] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63416 63416] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6946837 6946837] | ||
{{#set: smiles=CC1(=NC(=C(C[N+])C=N1)N)}} | {{#set: smiles=CC1(=NC(=C(C[N+])C=N1)N)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=139.18 }} | {{#set: molecular weight=139.18 }} | ||
| + | {{#set: inchi key=InChIKey=OZOHTVFCSKFMLL-UHFFFAOYSA-O}} | ||
| + | {{#set: common name=aminomethylpyrimidine}} | ||
{{#set: common name=4-amino-5-aminomethyl-2-methylpyrimidine|2-methyl-4-amino-5-aminomethylpyrimidine}} | {{#set: common name=4-amino-5-aminomethyl-2-methylpyrimidine|2-methyl-4-amino-5-aminomethylpyrimidine}} | ||
{{#set: consumed by=RXN-12613}} | {{#set: consumed by=RXN-12613}} | ||
Latest revision as of 13:25, 10 January 2019
Contents
Metabolite CPD-13578
- smiles:
- CC1(=NC(=C(C[N+])C=N1)N)
- molecular weight:
- 139.18
- inchi key:
- InChIKey=OZOHTVFCSKFMLL-UHFFFAOYSA-O
- common name:
- aminomethylpyrimidine
- Synonym(s):
- 4-amino-5-aminomethyl-2-methylpyrimidine
- 2-methyl-4-amino-5-aminomethylpyrimidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=NC(=C(C[N+])C=N1)N)" cannot be used as a page name in this wiki.
