Difference between revisions of "CPD-13188"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == * smiles: ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O)) | ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 488.442 | ** 488.442 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CWVRQJBCBCTFLT-CIVPZROJSA-N | ||
| + | * common name: | ||
| + | ** β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-D-Glcp | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=134389 134389] |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122706507 122706507] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C19966 C19966] | ||
{{#set: smiles=CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))}} | {{#set: smiles=CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=488.442 }} | {{#set: molecular weight=488.442 }} | ||
| + | {{#set: inchi key=InChIKey=CWVRQJBCBCTFLT-CIVPZROJSA-N}} | ||
| + | {{#set: common name=β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-D-Glcp}} | ||
{{#set: produced by=RXN-12270}} | {{#set: produced by=RXN-12270}} | ||
Latest revision as of 13:28, 10 January 2019
Contents
Metabolite CPD-13188
- smiles:
- CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))
- molecular weight:
- 488.442
- inchi key:
- InChIKey=CWVRQJBCBCTFLT-CIVPZROJSA-N
- common name:
- β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-D-Glcp
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
