Difference between revisions of "CPD-10806"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] == * smiles: ** CCCCCC(O)[CH]=CC=O * common name: ** 4-hydroxy-2-nonenal *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCC(O)[CH]=CC=O | ** CCCCCC(O)[CH]=CC=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 156.224 | ** 156.224 | ||
| + | * inchi key: | ||
| + | ** InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N | ||
| + | * common name: | ||
| + | ** 4-hydroxy-2-nonenal | ||
* Synonym(s): | * Synonym(s): | ||
** 4HNE | ** 4HNE | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC32585 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283344 5283344] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283344 5283344] | ||
| − | * | + | * HMDB : HMDB04362 |
| − | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32585 32585] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32585 32585] | ||
| − | * | + | * CHEMSPIDER: |
| − | * | + | ** [http://www.chemspider.com/Chemical-Structure.4446465.html 4446465] |
{{#set: smiles=CCCCCC(O)[CH]=CC=O}} | {{#set: smiles=CCCCCC(O)[CH]=CC=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=156.224 }} | {{#set: molecular weight=156.224 }} | ||
| + | {{#set: inchi key=InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N}} | ||
| + | {{#set: common name=4-hydroxy-2-nonenal}} | ||
{{#set: common name=4HNE}} | {{#set: common name=4HNE}} | ||
{{#set: consumed by=RXN-13673}} | {{#set: consumed by=RXN-13673}} | ||
Latest revision as of 13:30, 10 January 2019
Contents
Metabolite CPD-10806
- smiles:
- CCCCCC(O)[CH]=CC=O
- molecular weight:
- 156.224
- inchi key:
- InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N
- common name:
- 4-hydroxy-2-nonenal
- Synonym(s):
- 4HNE
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(O)[CH]=CC=O" cannot be used as a page name in this wiki.
