Difference between revisions of "TREHALOSE-6P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-]...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O | ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 420.263 | ** 420.263 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L | ||
| + | * common name: | ||
| + | ** α,α-trehalose 6-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** α,α-D-trehalose 6-phosphate | ** α,α-D-trehalose 6-phosphate | ||
| Line 15: | Line 15: | ||
* [[TREHALOSEPHOSPHA-RXN]] | * [[TREHALOSEPHOSPHA-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[UG6PGTn]] | * [[UG6PGTn]] | ||
* [[TREHALOSE6PSYN-RXN]] | * [[TREHALOSE6PSYN-RXN]] | ||
| + | * [[UG6PGT]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246105 25246105] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246105 25246105] | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58429 58429] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58429 58429] | ||
| + | * CAS : 4484-88-2 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00689 C00689] | ||
| + | * HMDB : HMDB01124 | ||
* BIGG : tre6p | * BIGG : tre6p | ||
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O}} | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=420.263 }} | {{#set: molecular weight=420.263 }} | ||
| + | {{#set: inchi key=InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L}} | ||
| + | {{#set: common name=α,α-trehalose 6-phosphate}} | ||
{{#set: common name=α,α-D-trehalose 6-phosphate}} | {{#set: common name=α,α-D-trehalose 6-phosphate}} | ||
{{#set: consumed by=TREHALOSEPHOSPHA-RXN}} | {{#set: consumed by=TREHALOSEPHOSPHA-RXN}} | ||
| − | {{#set: produced by= | + | {{#set: produced by=UG6PGTn|TREHALOSE6PSYN-RXN|UG6PGT}} |
Latest revision as of 13:35, 10 January 2019
Contents
Metabolite TREHALOSE-6P
- smiles:
- C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
- molecular weight:
- 420.263
- inchi key:
- InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
- common name:
- α,α-trehalose 6-phosphate
- Synonym(s):
- α,α-D-trehalose 6-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O" cannot be used as a page name in this wiki.
