Difference between revisions of "CPD-804"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-804 CPD-804] == * smiles: ** C(CCC(O)CC(C([O-])=O)=O)([O-])=O * common name: ** (4S)-4-hydr...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(CCC(O)CC(C([O-])=O)=O)([O-])=O | ** C(CCC(O)CC(C([O-])=O)=O)([O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 188.137 | ** 188.137 | ||
+ | * inchi key: | ||
+ | ** InChIKey=HNOAJOYERZTSNK-BYPYZUCNSA-L | ||
+ | * common name: | ||
+ | ** (4S)-4-hydroxy-2-oxoheptanedioate | ||
* Synonym(s): | * Synonym(s): | ||
** 4-hydroxy-2-ketoheptane-1,7-dioate | ** 4-hydroxy-2-ketoheptane-1,7-dioate | ||
Line 21: | Line 21: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.19951289.html 19951289] | ** [http://www.chemspider.com/Chemical-Structure.19951289.html 19951289] | ||
Line 29: | Line 27: | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05601 C05601] | ** [http://www.genome.jp/dbget-bin/www_bget?C05601 C05601] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91828275 91828275] | ||
{{#set: smiles=C(CCC(O)CC(C([O-])=O)=O)([O-])=O}} | {{#set: smiles=C(CCC(O)CC(C([O-])=O)=O)([O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=188.137 }} | {{#set: molecular weight=188.137 }} | ||
+ | {{#set: inchi key=InChIKey=HNOAJOYERZTSNK-BYPYZUCNSA-L}} | ||
+ | {{#set: common name=(4S)-4-hydroxy-2-oxoheptanedioate}} | ||
{{#set: common name=4-hydroxy-2-ketoheptane-1,7-dioate|2-oxo-4-hydroxyhepta-1,7-dioate|4-hydroxy-2-oxo-heptanedioate|4-hydroxy-2-ketopimelate|2-keto-4-hydroxypimelate}} | {{#set: common name=4-hydroxy-2-ketoheptane-1,7-dioate|2-oxo-4-hydroxyhepta-1,7-dioate|4-hydroxy-2-oxo-heptanedioate|4-hydroxy-2-ketopimelate|2-keto-4-hydroxypimelate}} | ||
{{#set: consumed by=4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN}} | {{#set: consumed by=4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN}} |
Latest revision as of 14:40, 10 January 2019
Contents
Metabolite CPD-804
- smiles:
- C(CCC(O)CC(C([O-])=O)=O)([O-])=O
- molecular weight:
- 188.137
- inchi key:
- InChIKey=HNOAJOYERZTSNK-BYPYZUCNSA-L
- common name:
- (4S)-4-hydroxy-2-oxoheptanedioate
- Synonym(s):
- 4-hydroxy-2-ketoheptane-1,7-dioate
- 2-oxo-4-hydroxyhepta-1,7-dioate
- 4-hydroxy-2-oxo-heptanedioate
- 4-hydroxy-2-ketopimelate
- 2-keto-4-hydroxypimelate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCC(O)CC(C([O-])=O)=O)([O-])=O" cannot be used as a page name in this wiki.