Difference between revisions of "CPD-15301"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2)) | ** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2)) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 633.085 | ** 633.085 | ||
+ | * inchi key: | ||
+ | ** InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** caldariellaquinol | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[RXN-15378]] | * [[RXN-15378]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * METABOLIGHTS : MTBLC73388 |
− | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73388 73388] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73388 73388] | ||
− | * | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C20623 C20623] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464569 71464569] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464569 71464569] | ||
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2))}} | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2))}} | ||
− | |||
− | |||
{{#set: molecular weight=633.085 }} | {{#set: molecular weight=633.085 }} | ||
− | {{#set: produced by= | + | {{#set: inchi key=InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N}} |
+ | {{#set: common name=caldariellaquinol}} | ||
+ | {{#set: produced by=RXN-15378}} |
Latest revision as of 13:43, 10 January 2019
Contents
Metabolite CPD-15301
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2))
- molecular weight:
- 633.085
- inchi key:
- InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N
- common name:
- caldariellaquinol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links