Difference between revisions of "CPD-14447"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14447 CPD-14447] == * smiles: ** C=CC=C(C([O-])=O)O * common name: ** (2Z)-2-hydroxypenta-2...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=CC=C(C([O-])=O)O | ** C=CC=C(C([O-])=O)O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 113.093 | ** 113.093 | ||
| + | * inchi key: | ||
| + | ** InChIKey=VHTQQDXPNUTMNB-ARJAWSKDSA-M | ||
| + | * common name: | ||
| + | ** (2Z)-2-hydroxypenta-2,4-dienoate | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
* [[MHPCHYDROL-RXN]] | * [[MHPCHYDROL-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67152 67152] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67152 67152] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54713710 54713710] | ||
{{#set: smiles=C=CC=C(C([O-])=O)O}} | {{#set: smiles=C=CC=C(C([O-])=O)O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=113.093 }} | {{#set: molecular weight=113.093 }} | ||
| + | {{#set: inchi key=InChIKey=VHTQQDXPNUTMNB-ARJAWSKDSA-M}} | ||
| + | {{#set: common name=(2Z)-2-hydroxypenta-2,4-dienoate}} | ||
{{#set: produced by=RXN-12070|MHPCHYDROL-RXN}} | {{#set: produced by=RXN-12070|MHPCHYDROL-RXN}} | ||
| − | |||
Latest revision as of 13:47, 10 January 2019
Contents
Metabolite CPD-14447
- smiles:
- C=CC=C(C([O-])=O)O
- molecular weight:
- 113.093
- inchi key:
- InChIKey=VHTQQDXPNUTMNB-ARJAWSKDSA-M
- common name:
- (2Z)-2-hydroxypenta-2,4-dienoate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC=C(C([O-])=O)O" cannot be used as a page name in this wiki.
