Difference between revisions of "CPD-17637"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] == * smiles: ** CCCCCC(O)CCCCCC([O-])=O * common name: ** 7-hydroxylaurate...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCC(O)CCCCCC([O-])=O | ** CCCCCC(O)CCCCCC([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 215.312 | ** 215.312 | ||
| + | * inchi key: | ||
| + | ** InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** 7-hydroxylaurate | ||
* Synonym(s): | * Synonym(s): | ||
** 7-hydroxydodecanoic acid | ** 7-hydroxydodecanoic acid | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84921 84921] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84921 84921] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659904 90659904] | ||
{{#set: smiles=CCCCCC(O)CCCCCC([O-])=O}} | {{#set: smiles=CCCCCC(O)CCCCCC([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=215.312 }} | {{#set: molecular weight=215.312 }} | ||
| + | {{#set: inchi key=InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=7-hydroxylaurate}} | ||
{{#set: common name=7-hydroxydodecanoic acid|7-hydroxylauric acid|7-hydroxydodecanoate}} | {{#set: common name=7-hydroxydodecanoic acid|7-hydroxylauric acid|7-hydroxydodecanoate}} | ||
{{#set: consumed by=RXN-12184}} | {{#set: consumed by=RXN-12184}} | ||
Latest revision as of 13:49, 10 January 2019
Contents
Metabolite CPD-17637
- smiles:
- CCCCCC(O)CCCCCC([O-])=O
- molecular weight:
- 215.312
- inchi key:
- InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M
- common name:
- 7-hydroxylaurate
- Synonym(s):
- 7-hydroxydodecanoic acid
- 7-hydroxylauric acid
- 7-hydroxydodecanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(O)CCCCCC([O-])=O" cannot be used as a page name in this wiki.
