Difference between revisions of "CPD-9895"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9895 CPD-9895] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C)C)C | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C)C)C | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 834.296 | ** 834.296 | ||
+ | * inchi key: | ||
+ | ** InChIKey=HGWUGDIATLOPBN-BHZQGFRMSA-M | ||
+ | * common name: | ||
+ | ** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate | ||
* Synonym(s): | * Synonym(s): | ||
** 3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid | ** 3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid | ||
Line 16: | Line 16: | ||
* [[RXN-9282]] | * [[RXN-9282]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62793 62793] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62793 62793] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54738022 54738022] | ||
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C)C)C}} | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C)C)C}} | ||
− | |||
− | |||
{{#set: molecular weight=834.296 }} | {{#set: molecular weight=834.296 }} | ||
+ | {{#set: inchi key=InChIKey=HGWUGDIATLOPBN-BHZQGFRMSA-M}} | ||
+ | {{#set: common name=3,4-dihydroxy-5-all-trans-decaprenylbenzoate}} | ||
{{#set: common name=3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid|3-decaprenyl-4,5-dihydroxybenzoate}} | {{#set: common name=3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid|3-decaprenyl-4,5-dihydroxybenzoate}} | ||
{{#set: consumed by=RXN-9282}} | {{#set: consumed by=RXN-9282}} | ||
− |
Latest revision as of 15:02, 10 January 2019
Contents
Metabolite CPD-9895
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C)C)C
- molecular weight:
- 834.296
- inchi key:
- InChIKey=HGWUGDIATLOPBN-BHZQGFRMSA-M
- common name:
- 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
- Synonym(s):
- 3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
- 3-decaprenyl-4,5-dihydroxybenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.