Difference between revisions of "CPD-606"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-606 CPD-606] == * smiles: ** C(O)C(O)COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))(=O)[O-]...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C(O)COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))(=O)[O-])(=O)[O-] | ** C(O)C(O)COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))(=O)[O-])(=O)[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 475.242 | ** 475.242 | ||
| + | * inchi key: | ||
| + | ** InChIKey=HHPOUCCVONEPRK-JBSYKWBFSA-L | ||
| + | * common name: | ||
| + | ** CDP-glycerol | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]] | * [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]] | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58311 58311] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659090 90659090] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659090 90659090] | ||
* HMDB : HMDB59599 | * HMDB : HMDB59599 | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00513 C00513] | ** [http://www.genome.jp/dbget-bin/www_bget?C00513 C00513] | ||
{{#set: smiles=C(O)C(O)COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))(=O)[O-])(=O)[O-]}} | {{#set: smiles=C(O)C(O)COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))(=O)[O-])(=O)[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=475.242 }} | {{#set: molecular weight=475.242 }} | ||
| + | {{#set: inchi key=InChIKey=HHPOUCCVONEPRK-JBSYKWBFSA-L}} | ||
| + | {{#set: common name=CDP-glycerol}} | ||
{{#set: reversible reaction associated=CDP-GLYCEROL-PYROPHOSPHATASE-RXN}} | {{#set: reversible reaction associated=CDP-GLYCEROL-PYROPHOSPHATASE-RXN}} | ||
Latest revision as of 14:03, 10 January 2019
Contents
Metabolite CPD-606
- smiles:
- C(O)C(O)COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))(=O)[O-])(=O)[O-]
- molecular weight:
- 475.242
- inchi key:
- InChIKey=HHPOUCCVONEPRK-JBSYKWBFSA-L
- common name:
- CDP-glycerol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.
