Difference between revisions of "2-ALPHA-HYDROXYETHYL-THPP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-]) | ** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-]) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 466.341 | ** 466.341 | ||
+ | * inchi key: | ||
+ | ** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L | ||
+ | * common name: | ||
+ | ** 2-(α-hydroxyethyl)thiamine diphosphate | ||
* Synonym(s): | * Synonym(s): | ||
** 2-(α-hydroxyethyl)-TPP | ** 2-(α-hydroxyethyl)-TPP | ||
Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
* [[PDHam2hi]] | * [[PDHam2hi]] | ||
+ | * [[PDHam2mi]] | ||
+ | * [[RXN-12508]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-12583]] | * [[RXN-12583]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14037]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487] | ||
{{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}} | {{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}} | ||
− | |||
− | |||
{{#set: molecular weight=466.341 }} | {{#set: molecular weight=466.341 }} | ||
+ | {{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=2-(α-hydroxyethyl)thiamine diphosphate}} | ||
{{#set: common name=2-(α-hydroxyethyl)-TPP|2-(α-hydroxyethyl)-ThPP}} | {{#set: common name=2-(α-hydroxyethyl)-TPP|2-(α-hydroxyethyl)-ThPP}} | ||
− | {{#set: consumed by= | + | {{#set: consumed by=PDHam2hi|PDHam2mi|RXN-12508}} |
{{#set: produced by=RXN-12583}} | {{#set: produced by=RXN-12583}} | ||
+ | {{#set: reversible reaction associated=RXN-14037}} |
Latest revision as of 15:04, 10 January 2019
Contents
Metabolite 2-ALPHA-HYDROXYETHYL-THPP
- smiles:
- CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
- molecular weight:
- 466.341
- inchi key:
- InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
- common name:
- 2-(α-hydroxyethyl)thiamine diphosphate
- Synonym(s):
- 2-(α-hydroxyethyl)-TPP
- 2-(α-hydroxyethyl)-ThPP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])" cannot be used as a page name in this wiki.