Difference between revisions of "CPD-7206"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7206 CPD-7206] == * smiles: ** CC(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)=CC=CC=C(C=CC=C(C=O)C)C *...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)=CC=CC=C(C=CC=C(C=O)C)C | ** CC(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)=CC=CC=C(C=CC=C(C=O)C)C | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 416.645 | ** 416.645 | ||
+ | * inchi key: | ||
+ | ** InChIKey=DFMMVLFMMAQXHZ-DOKBYWHISA-N | ||
+ | * common name: | ||
+ | ** 8'-apo-β-carotenal | ||
* Synonym(s): | * Synonym(s): | ||
** all-trans-8'-apo-β-carotenal | ** all-trans-8'-apo-β-carotenal | ||
Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.4585625.html 4585625] | ** [http://www.chemspider.com/Chemical-Structure.4585625.html 4585625] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53154 53154] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53154 53154] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C19728 C19728] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5478003 5478003] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5478003 5478003] | ||
{{#set: smiles=CC(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)=CC=CC=C(C=CC=C(C=O)C)C}} | {{#set: smiles=CC(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)=CC=CC=C(C=CC=C(C=O)C)C}} | ||
− | |||
− | |||
{{#set: molecular weight=416.645 }} | {{#set: molecular weight=416.645 }} | ||
+ | {{#set: inchi key=InChIKey=DFMMVLFMMAQXHZ-DOKBYWHISA-N}} | ||
+ | {{#set: common name=8'-apo-β-carotenal}} | ||
{{#set: common name=all-trans-8'-apo-β-carotenal|β-apo-8'-carotenal}} | {{#set: common name=all-trans-8'-apo-β-carotenal|β-apo-8'-carotenal}} | ||
{{#set: consumed by=RXN-11783}} | {{#set: consumed by=RXN-11783}} |
Latest revision as of 15:07, 10 January 2019
Contents
Metabolite CPD-7206
- smiles:
- CC(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)=CC=CC=C(C=CC=C(C=O)C)C
- molecular weight:
- 416.645
- inchi key:
- InChIKey=DFMMVLFMMAQXHZ-DOKBYWHISA-N
- common name:
- 8'-apo-β-carotenal
- Synonym(s):
- all-trans-8'-apo-β-carotenal
- β-apo-8'-carotenal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links