Difference between revisions of "CPD-18761"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * common name: ** coniferyl alco...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** COC1(=CC(=CCCO)C=CC(=O)1) | ** COC1(=CC(=CCCO)C=CC(=O)1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 179.195 | ** 179.195 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** coniferyl alcohol radical | ||
* Synonym(s): | * Synonym(s): | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122706626 122706626] | ||
{{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}} | {{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=179.195 }} | {{#set: molecular weight=179.195 }} | ||
| + | {{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=coniferyl alcohol radical}} | ||
{{#set: produced by=RXN-17352|RXN-17351}} | {{#set: produced by=RXN-17352|RXN-17351}} | ||
Latest revision as of 14:14, 10 January 2019
Contents
Metabolite CPD-18761
- smiles:
- COC1(=CC(=CCCO)C=CC(=O)1)
- molecular weight:
- 179.195
- inchi key:
- InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
- common name:
- coniferyl alcohol radical
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
