Difference between revisions of "DIHYDROSIROHYDROCHLORIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROSIROHYDROCHLORIN DIHYDROSIROHYDROCHLORIN] == * smiles: ** CC5(CC(=O)[O-])(C(C4(=CC1(NC(=...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-]) | ** CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-]) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 857.803 | ** 857.803 | ||
| + | * inchi key: | ||
| + | ** InChIKey=OQIIYZQTTMKFAU-ZNLOQLQNSA-G | ||
| + | * common name: | ||
| + | ** precorrin-2 | ||
* Synonym(s): | * Synonym(s): | ||
** dihydrosirohydrochlorin | ** dihydrosirohydrochlorin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8759]] | ||
* [[DIMETHUROPORDEHYDROG-RXN]] | * [[DIMETHUROPORDEHYDROG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[RXN-8675]] | * [[RXN-8675]] | ||
| + | * [[RXN-13403]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58827 58827] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58827 58827] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245987 25245987] | ||
| + | * CAS : 82542-92-5 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C02463 C02463] | ** [http://www.genome.jp/dbget-bin/www_bget?C02463 C02463] | ||
| + | * BIGG : dscl | ||
{{#set: smiles=CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-])}} | {{#set: smiles=CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-])}} | ||
| − | |||
| − | |||
{{#set: molecular weight=857.803 }} | {{#set: molecular weight=857.803 }} | ||
| + | {{#set: inchi key=InChIKey=OQIIYZQTTMKFAU-ZNLOQLQNSA-G}} | ||
| + | {{#set: common name=precorrin-2}} | ||
{{#set: common name=dihydrosirohydrochlorin}} | {{#set: common name=dihydrosirohydrochlorin}} | ||
| − | {{#set: consumed by=DIMETHUROPORDEHYDROG-RXN}} | + | {{#set: consumed by=RXN-8759|DIMETHUROPORDEHYDROG-RXN}} |
| − | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-8675|RXN-13403}} |
| − | + | ||
Latest revision as of 14:14, 10 January 2019
Contents
Metabolite DIHYDROSIROHYDROCHLORIN
- smiles:
- CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-])
- molecular weight:
- 857.803
- inchi key:
- InChIKey=OQIIYZQTTMKFAU-ZNLOQLQNSA-G
- common name:
- precorrin-2
- Synonym(s):
- dihydrosirohydrochlorin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-])" cannot be used as a page name in this wiki.
