Difference between revisions of "CPD-308"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * commo...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O | ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 303.294 | ** 303.294 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M | ||
| + | * common name: | ||
| + | ** D-nopaline | ||
* Synonym(s): | * Synonym(s): | ||
** N2-(D-1,3-dicarboxypropyl)-L-arginine | ** N2-(D-1,3-dicarboxypropyl)-L-arginine | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58074 58074] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58074 58074] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791983 49791983] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01682 C01682] | ** [http://www.genome.jp/dbget-bin/www_bget?C01682 C01682] | ||
{{#set: smiles=C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O}} | {{#set: smiles=C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=303.294 }} | {{#set: molecular weight=303.294 }} | ||
| + | {{#set: inchi key=InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M}} | ||
| + | {{#set: common name=D-nopaline}} | ||
{{#set: common name=N2-(D-1,3-dicarboxypropyl)-L-arginine}} | {{#set: common name=N2-(D-1,3-dicarboxypropyl)-L-arginine}} | ||
{{#set: produced by=1.5.1.19-RXN}} | {{#set: produced by=1.5.1.19-RXN}} | ||
Latest revision as of 14:21, 10 January 2019
Contents
Metabolite CPD-308
- smiles:
- C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
- molecular weight:
- 303.294
- inchi key:
- InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
- common name:
- D-nopaline
- Synonym(s):
- N2-(D-1,3-dicarboxypropyl)-L-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O" cannot be used as a page name in this wiki.
