Difference between revisions of "CPD-14122"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14122 CPD-14122] == * smiles: ** C1(C([N+])C(O)C(O)C(O)C(O)1) * common name: ** 2-deoxy-scy...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C([N+])C(O)C(O)C(O)C(O)1) | ** C1(C([N+])C(O)C(O)C(O)C(O)1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 164.181 | ** 164.181 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QXQNRSUOYNMXDL-KGJVWPDLSA-O | ||
| + | * common name: | ||
| + | ** 2-deoxy-scyllo-inosamine | ||
* Synonym(s): | * Synonym(s): | ||
** (1R,2S,3S,4R,5S)-5-aminocyclohexane-1,2,3,4-tetrol | ** (1R,2S,3S,4R,5S)-5-aminocyclohexane-1,2,3,4-tetrol | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65003 65003] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65003 65003] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339265 57339265] | ||
{{#set: smiles=C1(C([N+])C(O)C(O)C(O)C(O)1)}} | {{#set: smiles=C1(C([N+])C(O)C(O)C(O)C(O)1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=164.181 }} | {{#set: molecular weight=164.181 }} | ||
| + | {{#set: inchi key=InChIKey=QXQNRSUOYNMXDL-KGJVWPDLSA-O}} | ||
| + | {{#set: common name=2-deoxy-scyllo-inosamine}} | ||
{{#set: common name=(1R,2S,3S,4R,5S)-5-aminocyclohexane-1,2,3,4-tetrol|1-amino-1,2-dideoxy-scyllo-inositol}} | {{#set: common name=(1R,2S,3S,4R,5S)-5-aminocyclohexane-1,2,3,4-tetrol|1-amino-1,2-dideoxy-scyllo-inositol}} | ||
{{#set: consumed by=RXN-13118}} | {{#set: consumed by=RXN-13118}} | ||
Latest revision as of 14:23, 10 January 2019
Contents
Metabolite CPD-14122
- smiles:
- C1(C([N+])C(O)C(O)C(O)C(O)1)
- molecular weight:
- 164.181
- inchi key:
- InChIKey=QXQNRSUOYNMXDL-KGJVWPDLSA-O
- common name:
- 2-deoxy-scyllo-inosamine
- Synonym(s):
- (1R,2S,3S,4R,5S)-5-aminocyclohexane-1,2,3,4-tetrol
- 1-amino-1,2-dideoxy-scyllo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C([N+])C(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
