Difference between revisions of "CPD-8050"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8050 CPD-8050] == * smiles: ** C1(C(C(C(C(C1O)O)O)O)O)O * common name: ** scyllo-inositol *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C(C(C(C(C1O)O)O)O)O)O | ** C1(C(C(C(C(C1O)O)O)O)O)O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 180.157 | ** 180.157 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CDAISMWEOUEBRE-CDRYSYESSA-N | ||
| + | * common name: | ||
| + | ** scyllo-inositol | ||
* Synonym(s): | * Synonym(s): | ||
** quercinitol | ** quercinitol | ||
| Line 21: | Line 21: | ||
* [[RXN-13779]] | * [[RXN-13779]] | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC10642 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=10642 10642] | ||
* CAS : 488-59-5 | * CAS : 488-59-5 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C06153 C06153] | ** [http://www.genome.jp/dbget-bin/www_bget?C06153 C06153] | ||
| − | |||
| − | |||
| − | |||
{{#set: smiles=C1(C(C(C(C(C1O)O)O)O)O)O}} | {{#set: smiles=C1(C(C(C(C(C1O)O)O)O)O)O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=180.157 }} | {{#set: molecular weight=180.157 }} | ||
| + | {{#set: inchi key=InChIKey=CDAISMWEOUEBRE-CDRYSYESSA-N}} | ||
| + | {{#set: common name=scyllo-inositol}} | ||
{{#set: common name=quercinitol|scyllitol|cyclohexane-1,2,3,4,5,6-hexol|(1r,2r,3r,4r,5r,6r)-cyclohexane-1,2,3,4,5,6-hexol|1,3,5/2,4,6-cyclohexanehexol}} | {{#set: common name=quercinitol|scyllitol|cyclohexane-1,2,3,4,5,6-hexol|(1r,2r,3r,4r,5r,6r)-cyclohexane-1,2,3,4,5,6-hexol|1,3,5/2,4,6-cyclohexanehexol}} | ||
{{#set: reversible reaction associated=RXN-13779}} | {{#set: reversible reaction associated=RXN-13779}} | ||
Latest revision as of 14:24, 10 January 2019
Contents
Metabolite CPD-8050
- smiles:
- C1(C(C(C(C(C1O)O)O)O)O)O
- molecular weight:
- 180.157
- inchi key:
- InChIKey=CDAISMWEOUEBRE-CDRYSYESSA-N
- common name:
- scyllo-inositol
- Synonym(s):
- quercinitol
- scyllitol
- cyclohexane-1,2,3,4,5,6-hexol
- (1r,2r,3r,4r,5r,6r)-cyclohexane-1,2,3,4,5,6-hexol
- 1,3,5/2,4,6-cyclohexanehexol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
