Difference between revisions of "PARAOXON"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O * common name: **...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O | ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 275.197 | ** 275.197 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** paraoxon | ||
* Synonym(s): | * Synonym(s): | ||
** O,O-diethyl-O-p-nitrophenylphosphoric acid | ** O,O-diethyl-O-p-nitrophenylphosphoric acid | ||
| Line 20: | Line 20: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.9026.html 9026] | ** [http://www.chemspider.com/Chemical-Structure.9026.html 9026] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9395 9395] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27827 27827] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27827 27827] | ||
| + | * CAS : 311-45-5 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06606 C06606] | ||
| + | * HMDB : HMDB13035 | ||
{{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O}} | {{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=275.197 }} | {{#set: molecular weight=275.197 }} | ||
| + | {{#set: inchi key=InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=paraoxon}} | ||
{{#set: common name=O,O-diethyl-O-p-nitrophenylphosphoric acid|diethyl-p-nitrophenyl phosphate|phosphoric acid diethyl 4-nitrophenyl ester|diethyl paraoxon}} | {{#set: common name=O,O-diethyl-O-p-nitrophenylphosphoric acid|diethyl-p-nitrophenyl phosphate|phosphoric acid diethyl 4-nitrophenyl ester|diethyl paraoxon}} | ||
{{#set: consumed by=RXN-8746}} | {{#set: consumed by=RXN-8746}} | ||
Latest revision as of 14:26, 10 January 2019
Contents
Metabolite PARAOXON
- smiles:
- CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O
- molecular weight:
- 275.197
- inchi key:
- InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N
- common name:
- paraoxon
- Synonym(s):
- O,O-diethyl-O-p-nitrophenylphosphoric acid
- diethyl-p-nitrophenyl phosphate
- phosphoric acid diethyl 4-nitrophenyl ester
- diethyl paraoxon
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O" cannot be used as a page name in this wiki.
