Difference between revisions of "CPD-11540"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11540 CPD-11540] == * smiles: ** CC3(C(=O)C(O)C(O)C(OP(OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=C...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC3(C(=O)C(O)C(O)C(OP(OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))([O-])=O)O3) | ** CC3(C(=O)C(O)C(O)C(OP(OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))([O-])=O)O3) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 546.274 | ** 546.274 | ||
+ | * inchi key: | ||
+ | ** InChIKey=DDWGQQADOIMFOI-TYENRRDNSA-L | ||
+ | * common name: | ||
+ | ** UDP-4-dehydro-β-L-rhamnose | ||
* Synonym(s): | * Synonym(s): | ||
** UDP-4-keto-β-L-rhamnose | ** UDP-4-keto-β-L-rhamnose | ||
Line 19: | Line 19: | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=123131583 123131583] |
{{#set: smiles=CC3(C(=O)C(O)C(O)C(OP(OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))([O-])=O)O3)}} | {{#set: smiles=CC3(C(=O)C(O)C(O)C(OP(OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))([O-])=O)O3)}} | ||
− | |||
− | |||
{{#set: molecular weight=546.274 }} | {{#set: molecular weight=546.274 }} | ||
+ | {{#set: inchi key=InChIKey=DDWGQQADOIMFOI-TYENRRDNSA-L}} | ||
+ | {{#set: common name=UDP-4-dehydro-β-L-rhamnose}} | ||
{{#set: common name=UDP-4-keto-β-L-rhamnose}} | {{#set: common name=UDP-4-keto-β-L-rhamnose}} | ||
{{#set: consumed by=RXN-10740}} | {{#set: consumed by=RXN-10740}} | ||
{{#set: reversible reaction associated=RXN-18332}} | {{#set: reversible reaction associated=RXN-18332}} |
Latest revision as of 15:27, 10 January 2019
Contents
Metabolite CPD-11540
- smiles:
- CC3(C(=O)C(O)C(O)C(OP(OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))([O-])=O)O3)
- molecular weight:
- 546.274
- inchi key:
- InChIKey=DDWGQQADOIMFOI-TYENRRDNSA-L
- common name:
- UDP-4-dehydro-β-L-rhamnose
- Synonym(s):
- UDP-4-keto-β-L-rhamnose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC3(C(=O)C(O)C(O)C(OP(OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))([O-])=O)O3)" cannot be used as a page name in this wiki.