Difference between revisions of "N-SUCCINYLLL-2-6-DIAMINOPIMELATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-SUCCINYLLL-2-6-DIAMINOPIMELATE N-SUCCINYLLL-2-6-DIAMINOPIMELATE] == * smiles: ** C(CC([N+])C(...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(CC([N+])C(=O)[O-])CC(NC(CCC([O-])=O)=O)C([O-])=O | ** C(CC([N+])C(=O)[O-])CC(NC(CCC([O-])=O)=O)C([O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 288.257 | ** 288.257 | ||
+ | * inchi key: | ||
+ | ** InChIKey=GLXUWZBUPATPBR-BQBZGAKWSA-L | ||
+ | * common name: | ||
+ | ** N-succinyl-L,L-2,6-diaminopimelate | ||
* Synonym(s): | * Synonym(s): | ||
** N-succinyl-L-2,6-diaminoheptanedioate | ** N-succinyl-L-2,6-diaminoheptanedioate | ||
Line 19: | Line 19: | ||
* [[SUCCINYLDIAMINOPIMTRANS-RXN]] | * [[SUCCINYLDIAMINOPIMTRANS-RXN]] | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11948934 11948934] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11948934 11948934] | ||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58087 58087] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58087 58087] | ||
+ | * CAS : 26605-36-7 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04421 C04421] | ||
+ | * HMDB : HMDB12267 | ||
* BIGG : sl26da | * BIGG : sl26da | ||
{{#set: smiles=C(CC([N+])C(=O)[O-])CC(NC(CCC([O-])=O)=O)C([O-])=O}} | {{#set: smiles=C(CC([N+])C(=O)[O-])CC(NC(CCC([O-])=O)=O)C([O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=288.257 }} | {{#set: molecular weight=288.257 }} | ||
+ | {{#set: inchi key=InChIKey=GLXUWZBUPATPBR-BQBZGAKWSA-L}} | ||
+ | {{#set: common name=N-succinyl-L,L-2,6-diaminopimelate}} | ||
{{#set: common name=N-succinyl-L-2,6-diaminoheptanedioate|N-succinyl-LL-2,6-diaminoheptanedioate|L,L-SDAP}} | {{#set: common name=N-succinyl-L-2,6-diaminoheptanedioate|N-succinyl-LL-2,6-diaminoheptanedioate|L,L-SDAP}} | ||
{{#set: reversible reaction associated=SUCCINYLDIAMINOPIMTRANS-RXN}} | {{#set: reversible reaction associated=SUCCINYLDIAMINOPIMTRANS-RXN}} |
Latest revision as of 14:30, 10 January 2019
Contents
Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE
- smiles:
- C(CC([N+])C(=O)[O-])CC(NC(CCC([O-])=O)=O)C([O-])=O
- molecular weight:
- 288.257
- inchi key:
- InChIKey=GLXUWZBUPATPBR-BQBZGAKWSA-L
- common name:
- N-succinyl-L,L-2,6-diaminopimelate
- Synonym(s):
- N-succinyl-L-2,6-diaminoheptanedioate
- N-succinyl-LL-2,6-diaminoheptanedioate
- L,L-SDAP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC([N+])C(=O)[O-])CC(NC(CCC([O-])=O)=O)C([O-])=O" cannot be used as a page name in this wiki.