Difference between revisions of "COBINAMIDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] == * smiles: ** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8)))) | ** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8)))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 990.096 | ** 990.096 | ||
| + | * inchi key: | ||
| + | ** InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M | ||
| + | * common name: | ||
| + | ** cobinamide | ||
* Synonym(s): | * Synonym(s): | ||
** Cbi | ** Cbi | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820010 91820010] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820010 91820010] | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28956 28956] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28956 28956] | ||
| + | * CAS : 1867-62-5 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05774 C05774] | ||
| + | * HMDB : HMDB06902 | ||
* BIGG : cbi | * BIGG : cbi | ||
{{#set: smiles=CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))}} | {{#set: smiles=CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=990.096 }} | {{#set: molecular weight=990.096 }} | ||
| + | {{#set: inchi key=InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M}} | ||
| + | {{#set: common name=cobinamide}} | ||
{{#set: common name=Cbi|cobyrinic acid a,c-diamide}} | {{#set: common name=Cbi|cobyrinic acid a,c-diamide}} | ||
{{#set: consumed by=BTUR2-RXN}} | {{#set: consumed by=BTUR2-RXN}} | ||
Latest revision as of 14:37, 10 January 2019
Contents
Metabolite COBINAMIDE
- smiles:
- CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))
- molecular weight:
- 990.096
- inchi key:
- InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M
- common name:
- cobinamide
- Synonym(s):
- Cbi
- cobyrinic acid a,c-diamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))" cannot be used as a page name in this wiki.
