Difference between revisions of "CPD-321"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-321 CPD-321] == * smiles: ** C(CC([O-])=O)=[N+]([O-])[O-] * common name: ** 3-aci-nitroprop...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(CC([O-])=O)=[N+]([O-])[O-] | ** C(CC([O-])=O)=[N+]([O-])[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 117.061 | ** 117.061 | ||
| + | * inchi key: | ||
| + | ** InChIKey=KXXXIVRXVXKXPA-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** 3-aci-nitropropanoate | ||
* Synonym(s): | * Synonym(s): | ||
** propionate-3-nitronate | ** propionate-3-nitronate | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57892 57892] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57892 57892] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931115 46931115] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03071 C03071] | ** [http://www.genome.jp/dbget-bin/www_bget?C03071 C03071] | ||
{{#set: smiles=C(CC([O-])=O)=[N+]([O-])[O-]}} | {{#set: smiles=C(CC([O-])=O)=[N+]([O-])[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=117.061 }} | {{#set: molecular weight=117.061 }} | ||
| + | {{#set: inchi key=InChIKey=KXXXIVRXVXKXPA-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=3-aci-nitropropanoate}} | ||
{{#set: common name=propionate-3-nitronate|propanoate-3-nitronate|3-aci-nitoropropionic acid}} | {{#set: common name=propionate-3-nitronate|propanoate-3-nitronate|3-aci-nitoropropionic acid}} | ||
{{#set: consumed by=RXN-16322}} | {{#set: consumed by=RXN-16322}} | ||
Latest revision as of 14:40, 10 January 2019
Contents
Metabolite CPD-321
- smiles:
- C(CC([O-])=O)=[N+]([O-])[O-]
- molecular weight:
- 117.061
- inchi key:
- InChIKey=KXXXIVRXVXKXPA-UHFFFAOYSA-M
- common name:
- 3-aci-nitropropanoate
- Synonym(s):
- propionate-3-nitronate
- propanoate-3-nitronate
- 3-aci-nitoropropionic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC([O-])=O)=[N+]([O-])[O-" cannot be used as a page name in this wiki.
