Difference between revisions of "ZYMOSTEROL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ZYMOSTEROL ZYMOSTEROL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34)))) | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34)))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 384.644 | ** 384.644 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CGSJXLIKVBJVRY-XTGBIJOFSA-N | ||
| + | * common name: | ||
| + | ** zymosterol | ||
* Synonym(s): | * Synonym(s): | ||
** 5α-cholesta-8,24-dien-3β-ol | ** 5α-cholesta-8,24-dien-3β-ol | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN3O-178]] | * [[RXN3O-178]] | ||
| + | * [[RXN66-320]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN66-319]] | * [[RXN66-319]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92746 92746] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92746 92746] | ||
| − | * | + | * REFMET : Zymosterol |
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18252 18252] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18252 18252] | ||
| + | * CAS : 128-33-6 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05437 C05437] | ** [http://www.genome.jp/dbget-bin/www_bget?C05437 C05437] | ||
| + | * HMDB : HMDB06271 | ||
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))}} | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=384.644 }} | {{#set: molecular weight=384.644 }} | ||
| + | {{#set: inchi key=InChIKey=CGSJXLIKVBJVRY-XTGBIJOFSA-N}} | ||
| + | {{#set: common name=zymosterol}} | ||
{{#set: common name=5α-cholesta-8,24-dien-3β-ol|δ8, 24-cholestadien-3β-ol}} | {{#set: common name=5α-cholesta-8,24-dien-3β-ol|δ8, 24-cholestadien-3β-ol}} | ||
| − | {{#set: consumed by= | + | {{#set: consumed by=RXN3O-178|RXN66-320}} |
{{#set: produced by=RXN66-319}} | {{#set: produced by=RXN66-319}} | ||
Latest revision as of 14:46, 10 January 2019
Contents
Metabolite ZYMOSTEROL
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))
- molecular weight:
- 384.644
- inchi key:
- InChIKey=CGSJXLIKVBJVRY-XTGBIJOFSA-N
- common name:
- zymosterol
- Synonym(s):
- 5α-cholesta-8,24-dien-3β-ol
- δ8, 24-cholestadien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
