Difference between revisions of "CPD-14123"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14123 CPD-14123] == * smiles: ** C1(C([N+])C(O)C(O)C(O)C(=O)1) * common name: ** 3-amino-2,...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C([N+])C(O)C(O)C(O)C(=O)1) | ** C1(C([N+])C(O)C(O)C(O)C(=O)1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 162.165 | ** 162.165 | ||
+ | * inchi key: | ||
+ | ** InChIKey=FSUGCKMUTGKWIE-YGIVHSIPSA-O | ||
+ | * common name: | ||
+ | ** 3-amino-2,3-dideoxy-scyllo-inosose | ||
* Synonym(s): | * Synonym(s): | ||
** (2R,3S,4R,5S)-5-amino-2,3,4-trihydroxycyclohexan-1-one | ** (2R,3S,4R,5S)-5-amino-2,3,4-trihydroxycyclohexan-1-one | ||
Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65002 65002] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65002 65002] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339264 57339264] | ||
+ | * REFMET : 3-amino-2,3-dideoxy-scyllo-inosose | ||
{{#set: smiles=C1(C([N+])C(O)C(O)C(O)C(=O)1)}} | {{#set: smiles=C1(C([N+])C(O)C(O)C(O)C(=O)1)}} | ||
− | |||
− | |||
{{#set: molecular weight=162.165 }} | {{#set: molecular weight=162.165 }} | ||
+ | {{#set: inchi key=InChIKey=FSUGCKMUTGKWIE-YGIVHSIPSA-O}} | ||
+ | {{#set: common name=3-amino-2,3-dideoxy-scyllo-inosose}} | ||
{{#set: common name=(2R,3S,4R,5S)-5-amino-2,3,4-trihydroxycyclohexan-1-one|5-amino-2,3,4-trihydroxycyclohexanone}} | {{#set: common name=(2R,3S,4R,5S)-5-amino-2,3,4-trihydroxycyclohexan-1-one|5-amino-2,3,4-trihydroxycyclohexanone}} | ||
{{#set: produced by=RXN-13118}} | {{#set: produced by=RXN-13118}} |
Latest revision as of 15:52, 10 January 2019
Contents
Metabolite CPD-14123
- smiles:
- C1(C([N+])C(O)C(O)C(O)C(=O)1)
- molecular weight:
- 162.165
- inchi key:
- InChIKey=FSUGCKMUTGKWIE-YGIVHSIPSA-O
- common name:
- 3-amino-2,3-dideoxy-scyllo-inosose
- Synonym(s):
- (2R,3S,4R,5S)-5-amino-2,3,4-trihydroxycyclohexan-1-one
- 5-amino-2,3,4-trihydroxycyclohexanone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C([N+])C(O)C(O)C(O)C(=O)1)" cannot be used as a page name in this wiki.