Difference between revisions of "CPD-9067"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9067 CPD-9067] == * smiles: ** CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9)))))) | ** CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9)))))) | ||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 910.51 | ** 910.51 | ||
| + | * common name: | ||
| + | ** bacteriochlorophyll a | ||
* Synonym(s): | * Synonym(s): | ||
** bacteriochlorophyll a (phytol) | ** bacteriochlorophyll a (phytol) | ||
| Line 16: | Line 16: | ||
* [[RXN-8791]] | * [[RXN-8791]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30033 30033] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30033 30033] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122706388 122706388] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C11242 C11242] | ** [http://www.genome.jp/dbget-bin/www_bget?C11242 C11242] | ||
{{#set: smiles=CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))}} | {{#set: smiles=CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))}} | ||
| − | |||
{{#set: molecular weight=910.51 }} | {{#set: molecular weight=910.51 }} | ||
| + | {{#set: common name=bacteriochlorophyll a}} | ||
{{#set: common name=bacteriochlorophyll a (phytol)}} | {{#set: common name=bacteriochlorophyll a (phytol)}} | ||
{{#set: produced by=RXN-17426}} | {{#set: produced by=RXN-17426}} | ||
{{#set: reversible reaction associated=RXN-8791}} | {{#set: reversible reaction associated=RXN-8791}} | ||
Latest revision as of 14:56, 10 January 2019
Contents
Metabolite CPD-9067
- smiles:
- CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))
- molecular weight:
- 910.51
- common name:
- bacteriochlorophyll a
- Synonym(s):
- bacteriochlorophyll a (phytol)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))" cannot be used as a page name in this wiki.
