Difference between revisions of "PHYTYL-PYROPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTYL-PYROPHOSPHATE PHYTYL-PYROPHOSPHATE] == * smiles: ** CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP(...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C | ** CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 453.471 | ** 453.471 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K | ||
| + | * common name: | ||
| + | ** phytyl diphosphate | ||
* Synonym(s): | * Synonym(s): | ||
** phytyl pyrophosphate | ** phytyl pyrophosphate | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-7674]] | * [[RXN-7674]] | ||
| + | * [[RXN-2541]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-10625]] | * [[RXN-10625]] | ||
| Line 22: | Line 22: | ||
* [[RXN1F-66]] | * [[RXN1F-66]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75434 75434] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75434 75434] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728454 71728454] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05427 C05427] | ** [http://www.genome.jp/dbget-bin/www_bget?C05427 C05427] | ||
{{#set: smiles=CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}} | {{#set: smiles=CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=453.471 }} | {{#set: molecular weight=453.471 }} | ||
| + | {{#set: inchi key=InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K}} | ||
| + | {{#set: common name=phytyl diphosphate}} | ||
{{#set: common name=phytyl pyrophosphate|phytyl-PP}} | {{#set: common name=phytyl pyrophosphate|phytyl-PP}} | ||
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-7674|RXN-2541}} |
{{#set: produced by=RXN-10625}} | {{#set: produced by=RXN-10625}} | ||
{{#set: reversible reaction associated=RXN-7660|RXN1F-66}} | {{#set: reversible reaction associated=RXN-7660|RXN1F-66}} | ||
Latest revision as of 14:57, 10 January 2019
Contents
Metabolite PHYTYL-PYROPHOSPHATE
- smiles:
- CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
- molecular weight:
- 453.471
- inchi key:
- InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K
- common name:
- phytyl diphosphate
- Synonym(s):
- phytyl pyrophosphate
- phytyl-PP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.
