Difference between revisions of "CPD-12461"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12461 CPD-12461] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP([O-])([O-])=O)C)C)C | ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP([O-])([O-])=O)C)C)C | ||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 924.251 | ** 924.251 | ||
| + | * common name: | ||
| + | ** tri-trans,hepta-cis-undecaprenyl diphosphate | ||
* Synonym(s): | * Synonym(s): | ||
** tri-trans-poly-cis-undecaprenyl diphosphate | ** tri-trans-poly-cis-undecaprenyl diphosphate | ||
| Line 13: | Line 13: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[RXN-11488]] | * [[RXN-11488]] | ||
| + | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60388 60388] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60388 60388] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201038 25201038] | ||
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP([O-])([O-])=O)C)C)C}} | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP([O-])([O-])=O)C)C)C}} | ||
| − | |||
{{#set: molecular weight=924.251 }} | {{#set: molecular weight=924.251 }} | ||
| + | {{#set: common name=tri-trans,hepta-cis-undecaprenyl diphosphate}} | ||
{{#set: common name=tri-trans-poly-cis-undecaprenyl diphosphate|tri-trans,hepta-cis-undecaprenyl pyrophosphate}} | {{#set: common name=tri-trans-poly-cis-undecaprenyl diphosphate|tri-trans,hepta-cis-undecaprenyl pyrophosphate}} | ||
| − | {{#set: | + | {{#set: produced by=RXN-11488}} |
Latest revision as of 15:00, 10 January 2019
Contents
Metabolite CPD-12461
- smiles:
- CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP([O-])([O-])=O)C)C)C
- molecular weight:
- 924.251
- common name:
- tri-trans,hepta-cis-undecaprenyl diphosphate
- Synonym(s):
- tri-trans-poly-cis-undecaprenyl diphosphate
- tri-trans,hepta-cis-undecaprenyl pyrophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP([O-])([O-])=O)C)C)C" cannot be used as a page name in this wiki.
