Difference between revisions of "CPD-5661"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == | ||
* smiles: | * smiles: | ||
| − | ** CC | + | ** CC(C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))=CC=CC=C(C)C=CC=C(C)C=CC2(C(C)(C)CC(O)CC(C)=2) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
** 552.882 | ** 552.882 | ||
| + | * inchi key: | ||
| + | ** InChIKey=NBZANZVJRKXVBH-NHWXEJKLSA-N | ||
| + | * common name: | ||
| + | ** zeinoxanthin | ||
* Synonym(s): | * Synonym(s): | ||
** β,ε-carotene-3-ol | ** β,ε-carotene-3-ol | ||
| + | ** (3R,6'R)-β,ε-caroten-3-ol | ||
| + | ** 3-hydroxy-α-carotene | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 18: | Line 20: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.8487368.html 8487368] | ** [http://www.chemspider.com/Chemical-Structure.8487368.html 8487368] | ||
| Line 26: | Line 26: | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C08590 C08590] | ** [http://www.genome.jp/dbget-bin/www_bget?C08590 C08590] | ||
| − | {{#set: smiles=CC( | + | * PUBCHEM: |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10311902 10311902] | |
| − | + | {{#set: smiles=CC(C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))=CC=CC=C(C)C=CC=C(C)C=CC2(C(C)(C)CC(O)CC(C)=2)}} | |
{{#set: molecular weight=552.882 }} | {{#set: molecular weight=552.882 }} | ||
| − | {{#set: common name=β,ε-carotene-3-ol}} | + | {{#set: inchi key=InChIKey=NBZANZVJRKXVBH-NHWXEJKLSA-N}} |
| + | {{#set: common name=zeinoxanthin}} | ||
| + | {{#set: common name=β,ε-carotene-3-ol|(3R,6'R)-β,ε-caroten-3-ol|3-hydroxy-α-carotene}} | ||
{{#set: consumed by=RXN-5962}} | {{#set: consumed by=RXN-5962}} | ||
{{#set: produced by=RXN-5961}} | {{#set: produced by=RXN-5961}} | ||
Latest revision as of 15:11, 10 January 2019
Contents
Metabolite CPD-5661
- smiles:
- CC(C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))=CC=CC=C(C)C=CC=C(C)C=CC2(C(C)(C)CC(O)CC(C)=2)
- molecular weight:
- 552.882
- inchi key:
- InChIKey=NBZANZVJRKXVBH-NHWXEJKLSA-N
- common name:
- zeinoxanthin
- Synonym(s):
- β,ε-carotene-3-ol
- (3R,6'R)-β,ε-caroten-3-ol
- 3-hydroxy-α-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
