Difference between revisions of "CPD0-1445"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1445 CPD0-1445] == * smiles: ** CC([N+])C(=O)NC(C([O-])=O)CCC(=O)[O-] * common name: ** L-...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC([N+])C(=O)NC(C([O-])=O)CCC(=O)[O-] | ** CC([N+])C(=O)NC(C([O-])=O)CCC(=O)[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 217.201 | ** 217.201 | ||
| + | * inchi key: | ||
| + | ** InChIKey=VYZAGTDAHUIRQA-WHFBIAKZSA-M | ||
| + | * common name: | ||
| + | ** L-alanyl-L-glutamate | ||
* Synonym(s): | * Synonym(s): | ||
** L-Ala-L-Glu | ** L-Ala-L-Glu | ||
| − | ** | + | ** Ala-Glu |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 17: | Line 17: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.5370726.html 5370726] | ** [http://www.chemspider.com/Chemical-Structure.5370726.html 5370726] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7006474 7006474] | ||
| + | * CAS : 13187-90-1 | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61396 61396] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61396 61396] | ||
* BIGG : LalaLglu | * BIGG : LalaLglu | ||
{{#set: smiles=CC([N+])C(=O)NC(C([O-])=O)CCC(=O)[O-]}} | {{#set: smiles=CC([N+])C(=O)NC(C([O-])=O)CCC(=O)[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=217.201 }} | {{#set: molecular weight=217.201 }} | ||
| − | {{#set: common name=L-Ala-L-Glu| | + | {{#set: inchi key=InChIKey=VYZAGTDAHUIRQA-WHFBIAKZSA-M}} |
| + | {{#set: common name=L-alanyl-L-glutamate}} | ||
| + | {{#set: common name=L-Ala-L-Glu|Ala-Glu}} | ||
{{#set: consumed by=RXN0-6981}} | {{#set: consumed by=RXN0-6981}} | ||
| − | |||
Latest revision as of 15:11, 10 January 2019
Contents
Metabolite CPD0-1445
- smiles:
- CC([N+])C(=O)NC(C([O-])=O)CCC(=O)[O-]
- molecular weight:
- 217.201
- inchi key:
- InChIKey=VYZAGTDAHUIRQA-WHFBIAKZSA-M
- common name:
- L-alanyl-L-glutamate
- Synonym(s):
- L-Ala-L-Glu
- Ala-Glu
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC([N+])C(=O)NC(C([O-])=O)CCC(=O)[O-" cannot be used as a page name in this wiki.
