Difference between revisions of "3-HYDROXY-ISOVALERYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] == * smiles: ** CC(COP(=O)([O-])OP(=O)([O-])...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O | ** CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 863.619 | ** 863.619 | ||
+ | * inchi key: | ||
+ | ** InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J | ||
+ | * common name: | ||
+ | ** 3-hydroxyisovaleryl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
** 3-hydroxy-isovaleryl-coa | ** 3-hydroxy-isovaleryl-coa | ||
Line 19: | Line 19: | ||
* [[ECH_LPAREN_3hivcoa_RPAREN_]] | * [[ECH_LPAREN_3hivcoa_RPAREN_]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62555 62555] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62555 62555] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203667 25203667] | ||
{{#set: smiles=CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O}} | {{#set: smiles=CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O}} | ||
− | |||
− | |||
{{#set: molecular weight=863.619 }} | {{#set: molecular weight=863.619 }} | ||
+ | {{#set: inchi key=InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J}} | ||
+ | {{#set: common name=3-hydroxyisovaleryl-CoA}} | ||
{{#set: common name=3-hydroxy-isovaleryl-coa|3-hydroxy-iso-valeryl-CoA}} | {{#set: common name=3-hydroxy-isovaleryl-coa|3-hydroxy-iso-valeryl-CoA}} | ||
{{#set: reversible reaction associated=RXN-14266|ECH_LPAREN_3hivcoa_RPAREN_}} | {{#set: reversible reaction associated=RXN-14266|ECH_LPAREN_3hivcoa_RPAREN_}} |
Latest revision as of 16:27, 10 January 2019
Contents
Metabolite 3-HYDROXY-ISOVALERYL-COA
- smiles:
- CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O
- molecular weight:
- 863.619
- inchi key:
- InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J
- common name:
- 3-hydroxyisovaleryl-CoA
- Synonym(s):
- 3-hydroxy-isovaleryl-coa
- 3-hydroxy-iso-valeryl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O" cannot be used as a page name in this wiki.