Difference between revisions of "CPD-13395"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13395 CPD-13395] == * smiles: ** C([N+])C(=O)NC(CC(N)=O)C([O-])=O * common name: ** glycyl-...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([N+])C(=O)NC(CC(N)=O)C([O-])=O | ** C([N+])C(=O)NC(CC(N)=O)C([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 189.171 | ** 189.171 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FUESBOMYALLFNI-VKHMYHEASA-N | ||
| + | * common name: | ||
| + | ** glycyl-L-asparagine | ||
* Synonym(s): | * Synonym(s): | ||
** gly-asn | ** gly-asn | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC73888 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1595403 1595403] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1595403 1595403] | ||
| + | * HMDB : HMDB28836 | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74391 74391] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74391 74391] | ||
| − | |||
| − | |||
{{#set: smiles=C([N+])C(=O)NC(CC(N)=O)C([O-])=O}} | {{#set: smiles=C([N+])C(=O)NC(CC(N)=O)C([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=189.171 }} | {{#set: molecular weight=189.171 }} | ||
| + | {{#set: inchi key=InChIKey=FUESBOMYALLFNI-VKHMYHEASA-N}} | ||
| + | {{#set: common name=glycyl-L-asparagine}} | ||
{{#set: common name=gly-asn}} | {{#set: common name=gly-asn}} | ||
{{#set: consumed by=RXN0-6982}} | {{#set: consumed by=RXN0-6982}} | ||
Latest revision as of 15:29, 10 January 2019
Contents
Metabolite CPD-13395
- smiles:
- C([N+])C(=O)NC(CC(N)=O)C([O-])=O
- molecular weight:
- 189.171
- inchi key:
- InChIKey=FUESBOMYALLFNI-VKHMYHEASA-N
- common name:
- glycyl-L-asparagine
- Synonym(s):
- gly-asn
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])C(=O)NC(CC(N)=O)C([O-])=O" cannot be used as a page name in this wiki.
