Difference between revisions of "4-HYDROXY-L-PROLINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == * smiles: ** C1([N+]C(C(=O)[O-])CC(O)1) * common na...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1([N+]C(C(=O)[O-])CC(O)1) | ** C1([N+]C(C(=O)[O-])CC(O)1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 131.131 | ** 131.131 | ||
| + | * inchi key: | ||
| + | ** InChIKey=PMMYEEVYMWASQN-DMTCNVIQSA-N | ||
| + | * common name: | ||
| + | ** trans-4-hydroxy-L-proline | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** trans-4-hydroxy-L-proline | ||
** trans-4-hydroxyproline | ** trans-4-hydroxyproline | ||
** trans-oxyproline | ** trans-oxyproline | ||
| Line 19: | Line 20: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[RXN490-3641]] | * [[RXN490-3641]] | ||
| + | * [[RXN66-546]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* NCI: | * NCI: | ||
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46704 46704] | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46704 46704] | ||
| − | * | + | * METABOLIGHTS : MTBLC58375 |
| + | * REFMET : Trans-4-hydroxyproline | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971053 6971053] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58375 58375] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58375 58375] | ||
| − | * | + | * CAS : 51-35-4 |
| + | * HMDB : HMDB00725 | ||
{{#set: smiles=C1([N+]C(C(=O)[O-])CC(O)1)}} | {{#set: smiles=C1([N+]C(C(=O)[O-])CC(O)1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=131.131 }} | {{#set: molecular weight=131.131 }} | ||
| − | {{#set: common name=trans-4-hydroxyproline|trans-oxyproline|trans-L-4-hydroxyproline|trans-hydroxy-L-proline|trans-L-4-hydroxy-proline|(2S,4R)-4-hydroxypyrrolidinium-2-carboxylate}} | + | {{#set: inchi key=InChIKey=PMMYEEVYMWASQN-DMTCNVIQSA-N}} |
| − | {{#set: produced by= | + | {{#set: common name=trans-4-hydroxy-L-proline}} |
| + | {{#set: common name=trans-4-hydroxy-L-proline|trans-4-hydroxyproline|trans-oxyproline|trans-L-4-hydroxyproline|trans-hydroxy-L-proline|trans-L-4-hydroxy-proline|(2S,4R)-4-hydroxypyrrolidinium-2-carboxylate}} | ||
| + | {{#set: produced by=RXN490-3641|RXN66-546}} | ||
Latest revision as of 15:31, 10 January 2019
Contents
Metabolite 4-HYDROXY-L-PROLINE
- smiles:
- C1([N+]C(C(=O)[O-])CC(O)1)
- molecular weight:
- 131.131
- inchi key:
- InChIKey=PMMYEEVYMWASQN-DMTCNVIQSA-N
- common name:
- trans-4-hydroxy-L-proline
- Synonym(s):
- trans-4-hydroxy-L-proline
- trans-4-hydroxyproline
- trans-oxyproline
- trans-L-4-hydroxyproline
- trans-hydroxy-L-proline
- trans-L-4-hydroxy-proline
- (2S,4R)-4-hydroxypyrrolidinium-2-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- NCI:
- METABOLIGHTS : MTBLC58375
- REFMET : Trans-4-hydroxyproline
- PUBCHEM:
- CHEBI:
- CAS : 51-35-4
- HMDB : HMDB00725
"C1([N+]C(C(=O)[O-])CC(O)1)" cannot be used as a page name in this wiki.
