Difference between revisions of "CPD-15656"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15656 CPD-15656] == * smiles: ** CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 929.765 | ** 929.765 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CAVMKINPGRCURL-PHHHIDLGSA-J | ||
| + | * common name: | ||
| + | ** (3E)-undec-2-enoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
** 2E-undecenoyl-CoA | ** 2E-undecenoyl-CoA | ||
| + | ** 2-trans-undecenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 17: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77548 77548] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77548 77548] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289266 86289266] | ||
{{#set: smiles=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=929.765 }} | {{#set: molecular weight=929.765 }} | ||
| − | {{#set: common name=2E-undecenoyl-CoA}} | + | {{#set: inchi key=InChIKey=CAVMKINPGRCURL-PHHHIDLGSA-J}} |
| + | {{#set: common name=(3E)-undec-2-enoyl-CoA}} | ||
| + | {{#set: common name=2E-undecenoyl-CoA|2-trans-undecenoyl-CoA}} | ||
{{#set: consumed by=RXN-14778}} | {{#set: consumed by=RXN-14778}} | ||
Latest revision as of 15:31, 10 January 2019
Contents
Metabolite CPD-15656
- smiles:
- CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 929.765
- inchi key:
- InChIKey=CAVMKINPGRCURL-PHHHIDLGSA-J
- common name:
- (3E)-undec-2-enoyl-CoA
- Synonym(s):
- 2E-undecenoyl-CoA
- 2-trans-undecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
