Difference between revisions of "1516-DIHYDROBILIVERDIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O) | ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 582.655 | ** 582.655 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L | ||
+ | * common name: | ||
+ | ** 15,16-dihydrobiliverdin | ||
* Synonym(s): | * Synonym(s): | ||
Line 19: | Line 19: | ||
* [[R05819]] | * [[R05819]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901] | ||
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} | {{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} | ||
− | |||
− | |||
{{#set: molecular weight=582.655 }} | {{#set: molecular weight=582.655 }} | ||
+ | {{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}} | ||
+ | {{#set: common name=15,16-dihydrobiliverdin}} | ||
{{#set: consumed by=1.3.7.3-RXN}} | {{#set: consumed by=1.3.7.3-RXN}} | ||
{{#set: produced by=1.3.7.2-RXN}} | {{#set: produced by=1.3.7.2-RXN}} | ||
{{#set: reversible reaction associated=R05818|R05819}} | {{#set: reversible reaction associated=R05818|R05819}} |
Latest revision as of 13:17, 10 January 2019
Contents
Metabolite 1516-DIHYDROBILIVERDIN
- smiles:
- C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
- molecular weight:
- 582.655
- inchi key:
- InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
- common name:
- 15,16-dihydrobiliverdin
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.