Difference between revisions of "2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE] == * smiles: ** C(C(...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C(C(C(COP([O-])([O-])=O)(C([O-])=O)O)O)O)O | ** C(C(C(C(COP([O-])([O-])=O)(C([O-])=O)O)O)O)O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 273.113 | ** 273.113 | ||
+ | * inchi key: | ||
+ | ** InChIKey=UJTMIRNFEXKGMS-UHFFFAOYSA-K | ||
+ | * common name: | ||
+ | ** 2-carboxy-D-arabinitol 1-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** 2-carboxyarabinitol 1-phosphate | ** 2-carboxyarabinitol 1-phosphate | ||
− | ** | + | ** 2-C-((phosphooxy)methyl)-D-ribonic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17541 17541] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17541 17541] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203884 25203884] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04234 C04234] | ** [http://www.genome.jp/dbget-bin/www_bget?C04234 C04234] | ||
{{#set: smiles=C(C(C(C(COP([O-])([O-])=O)(C([O-])=O)O)O)O)O}} | {{#set: smiles=C(C(C(C(COP([O-])([O-])=O)(C([O-])=O)O)O)O)O}} | ||
− | |||
− | |||
{{#set: molecular weight=273.113 }} | {{#set: molecular weight=273.113 }} | ||
− | {{#set: common name=2-carboxyarabinitol 1-phosphate| | + | {{#set: inchi key=InChIKey=UJTMIRNFEXKGMS-UHFFFAOYSA-K}} |
+ | {{#set: common name=2-carboxy-D-arabinitol 1-phosphate}} | ||
+ | {{#set: common name=2-carboxyarabinitol 1-phosphate|2-C-((phosphooxy)methyl)-D-ribonic acid}} | ||
{{#set: consumed by=2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN}} | {{#set: consumed by=2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN}} |
Latest revision as of 12:37, 10 January 2019
Contents
Metabolite 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE
- smiles:
- C(C(C(C(COP([O-])([O-])=O)(C([O-])=O)O)O)O)O
- molecular weight:
- 273.113
- inchi key:
- InChIKey=UJTMIRNFEXKGMS-UHFFFAOYSA-K
- common name:
- 2-carboxy-D-arabinitol 1-phosphate
- Synonym(s):
- 2-carboxyarabinitol 1-phosphate
- 2-C-((phosphooxy)methyl)-D-ribonic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(C(C(COP([O-])([O-])=O)(C([O-])=O)O)O)O)O" cannot be used as a page name in this wiki.