Difference between revisions of "Beta-D-Glucans"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SPONTPRO-RXN SPONTPRO-RXN] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * Wi...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SPONTPRO-RXN SPONTPRO-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[L-DELTA1-PYRROLINE_5-CARBOXYLATE]][c] '''<=>''' 1 [[L-GLUTAMATE_GAMMA-SEMIALDEHYDE]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 H+[c] '''+''' 1 H2O[c] '''+''' 1 (S)-1-pyrroline-5-carboxylate[c] '''<=>''' 1 L-glutamate-5-semialdehyde[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | == Pathways == |
− | == | + | * [[PWY-6922]], L-Nδ-acetylornithine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6922 PWY-6922] |
+ | ** '''6''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-6853]], ethylene biosynthesis II (microbes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6853 PWY-6853] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6344]], L-ornithine degradation II (Stickland reaction): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6344 PWY-6344] | ||
+ | ** '''4''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-3341]], L-proline biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3341 PWY-3341] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PROUT-PWY]], L-proline degradation: [http://metacyc.org/META/NEW-IMAGE?object=PROUT-PWY PROUT-PWY] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[ARG-PRO-PWY]], L-arginine degradation VI (arginase 2 pathway): [http://metacyc.org/META/NEW-IMAGE?object=ARG-PRO-PWY ARG-PRO-PWY] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-7770]], indolmycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7770 PWY-7770] | ||
+ | ** '''1''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[PWY-4981]], L-proline biosynthesis II (from arginine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4981 PWY-4981] | ||
+ | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PROSYN-PWY]], L-proline biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PROSYN-PWY PROSYN-PWY] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[CITRULBIO-PWY]], L-citrulline biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=CITRULBIO-PWY CITRULBIO-PWY] | ||
+ | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[experimental_annotation]] | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28234 28234] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03314 R03314] | |
− | * LIGAND- | + | {{#set: direction=REVERSIBLE}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-6922|PWY-6853|PWY-6344|PWY-3341|PROUT-PWY|ARG-PRO-PWY|PWY-7770|PWY-4981|PROSYN-PWY|CITRULBIO-PWY}} |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 15:43, 10 January 2018
Contents
Reaction SPONTPRO-RXN
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 WATER[c] + 1 L-DELTA1-PYRROLINE_5-CARBOXYLATE[c] <=> 1 L-GLUTAMATE_GAMMA-SEMIALDEHYDE[c]
- With common name(s):
- 1 H+[c] + 1 H2O[c] + 1 (S)-1-pyrroline-5-carboxylate[c] <=> 1 L-glutamate-5-semialdehyde[c]
Genes associated with this reaction
Pathways
- PWY-6922, L-Nδ-acetylornithine biosynthesis: PWY-6922
- 6 reactions found over 7 reactions in the full pathway
- PWY-6853, ethylene biosynthesis II (microbes): PWY-6853
- 2 reactions found over 5 reactions in the full pathway
- PWY-6344, L-ornithine degradation II (Stickland reaction): PWY-6344
- 4 reactions found over 9 reactions in the full pathway
- PWY-3341, L-proline biosynthesis III: PWY-3341
- 5 reactions found over 5 reactions in the full pathway
- PROUT-PWY, L-proline degradation: PROUT-PWY
- 3 reactions found over 3 reactions in the full pathway
- ARG-PRO-PWY, L-arginine degradation VI (arginase 2 pathway): ARG-PRO-PWY
- 4 reactions found over 4 reactions in the full pathway
- PWY-7770, indolmycin biosynthesis: PWY-7770
- 1 reactions found over 10 reactions in the full pathway
- PWY-4981, L-proline biosynthesis II (from arginine): PWY-4981
- 4 reactions found over 6 reactions in the full pathway
- PROSYN-PWY, L-proline biosynthesis I: PROSYN-PWY
- 4 reactions found over 4 reactions in the full pathway
- CITRULBIO-PWY, L-citrulline biosynthesis: CITRULBIO-PWY
- 8 reactions found over 8 reactions in the full pathway
Reconstruction information
External links