Difference between revisions of "DNA-containing-diamino-hydro-formamidops"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] == * smiles: ** CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_CL- ExchangeSeed_CL-] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_CL- ExchangeSeed_CL-] ==
−
* smiles:
+
* direction:
−
** CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J
+
−
* common name:
+
−
** 2-methylbutanoyl-CoA
+
−
* molecular weight:
+
−
** 847.62   
+
 
* Synonym(s):
 
* Synonym(s):
−
** S-2-methyl-butyryl-CoA
 
−
** 2-methylbutyryl-CoA
 
−
** α-methylbutyryl-CoA
 
−
** α-methylbutanoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[MCDH_2mb2coa]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CL-]][C-BOUNDARY] '''<=>''' 1.0 [[CL-]][e]
−
* [[DHRT_2mbcoa]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 chloride[C-BOUNDARY] '''<=>''' 1.0 chloride[e]
−
* [[2KETO-3METHYLVALERATE-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[manual]]:
 +
** [[added to manage seeds from boundary to extracellular compartment]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266569 45266569]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=manual}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57336 57336]
+
{{#set: reconstruction source=added to manage seeds from boundary to extracellular compartment}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01033 C01033]
+
−
* HMDB : HMDB01041
+
−
{{#set: smiles=CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J}}
+
−
{{#set: common name=2-methylbutanoyl-CoA}}
+
−
{{#set: molecular weight=847.62    }}
+
−
{{#set: common name=S-2-methyl-butyryl-CoA|2-methylbutyryl-CoA|&alpha;-methylbutyryl-CoA|&alpha;-methylbutanoyl-CoA}}
+
−
{{#set: consumed by=MCDH_2mb2coa}}
+
−
{{#set: produced by=DHRT_2mbcoa}}
+
−
{{#set: consumed or produced by=2KETO-3METHYLVALERATE-RXN}}
+

Revision as of 15:46, 10 January 2018

Reaction ExchangeSeed_CL-

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
    • 1.0 CL-[C-BOUNDARY] <=> 1.0 CL-[e]
  • With common name(s):
    • 1.0 chloride[C-BOUNDARY] <=> 1.0 chloride[e]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DNA-containing-diamino-hydro-formamidops&oldid=10358"