Difference between revisions of "Tiso gene 17423"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] == * smiles: ** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3435 == * Synonym(s): == Reactions associated == * GLUTAMIN-RXN ** in-silico_annotation ***automated-name-match == Pathways associated...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] ==
+
== Gene Tiso_gene_3435 ==
* smiles:
+
** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
+
* common name:
+
** (2E,11Z)-octadecenoyl-CoA
+
* molecular weight:
+
** 1025.937   
+
 
* Synonym(s):
 
* Synonym(s):
** 18:2-Δ2,Δ11-CoA
 
** 2-trans,11-cis-octadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[GLUTAMIN-RXN]]
* [[RXN-17784]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 +
* [[GLUTAMINDEG-PWY]]
 +
* [[CITRULBIO-PWY]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=GLUTAMIN-RXN}}
{{#set: inchi key=InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J}}
+
{{#set: pathway associated=GLUTAMINDEG-PWY|CITRULBIO-PWY}}
{{#set: common name=(2E,11Z)-octadecenoyl-CoA}}
+
{{#set: molecular weight=1025.937    }}
+
{{#set: common name=18:2-Δ2,Δ11-CoA|2-trans,11-cis-octadecenoyl-CoA}}
+
{{#set: produced by=RXN-17784}}
+

Revision as of 15:50, 10 January 2018

Gene Tiso_gene_3435

  • Synonym(s):

Reactions associated

Pathways associated

External links