Difference between revisions of "PWY-6700"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Leader-Sequences Leader-Sequences] == * common name: ** a leader sequence * Synonym(s): == Rea...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Leader-Sequences Leader-Sequences] ==
* smiles:
+
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
+
* inchi key:
+
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
** bisorganyltrisulfane
+
** a leader sequence
* molecular weight:
+
** 644.686   
+
 
* Synonym(s):
 
* Synonym(s):
** GS3G
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.4.21.89-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-10851]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a leader sequence}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
+
{{#set: produced by=3.4.21.89-RXN}}
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
+
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
+
{{#set: common name=bisorganyltrisulfane}}
+
{{#set: molecular weight=644.686    }}
+
{{#set: common name=GS3G}}
+
{{#set: consumed or produced by=RXN-10851}}
+

Revision as of 15:53, 10 January 2018

Metabolite Leader-Sequences

  • common name:
    • a leader sequence
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links