Difference between revisions of "Tiso gene 15093"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-D-GLUCARATE 2-KETO-3-DEOXY-D-GLUCARATE] == * smiles: ** C(C(CC(C(C([O-])=O)O)O)=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6955 PWY-6955] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-D-GLUCARATE 2-KETO-3-DEOXY-D-GLUCARATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6955 PWY-6955] ==
* smiles:
+
* taxonomic range:
** C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L
+
 
* common name:
 
* common name:
** (2S,3S)-2,3-dihydroxy-5-oxohexanedioate
+
** lincomycin biosynthesis
* molecular weight:
+
** 190.109   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-deoxy-L-allo-hex-2-ulosarate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
* '''1''' reaction(s) found
== Reaction(s) of unknown directionality ==
+
** [[RXN-5861]]
* [[4.1.2.20-RXN]]
+
== Reaction(s) not found ==
 +
* '''7''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12852 RXN-12852]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12855 RXN-12855]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12851 RXN-12851]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12854 RXN-12854]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12860 RXN-12860]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12859 RXN-12859]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=STIZOLOBINATE-SYNTHASE-RXN STIZOLOBINATE-SYNTHASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245202 25245202]
+
{{#set: common name=lincomycin biosynthesis}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58098 58098]
+
{{#set: reaction not found=7}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03921 C03921]
+
{{#set: smiles=C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O}}
+
{{#set: inchi key=InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L}}
+
{{#set: common name=(2S,3S)-2,3-dihydroxy-5-oxohexanedioate}}
+
{{#set: molecular weight=190.109    }}
+
{{#set: common name=3-deoxy-L-allo-hex-2-ulosarate}}
+
{{#set: consumed or produced by=4.1.2.20-RXN}}
+

Revision as of 15:53, 10 January 2018

Pathway PWY-6955

  • taxonomic range:
  • common name:
    • lincomycin biosynthesis
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links