Difference between revisions of "Tiso gene 16490"

Revision as of 15:58, 10 January 2018

"CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_8474 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] ==
-* left end position:
+* smiles:
-** 628
+** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
-* transcription direction:
+* inchi key:
-** NEGATIVE
+** InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L
-* right end position:
+* common name:
-** 3163
+** 3-isopropyl-8-(methylthio)-2-oxooctanoate
-* centisome position:
+* molecular weight:
-** 6.1604867
+** 246.278
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[STRICTOSIDINE-SYNTHASE-RXN]]
+* [[RXN-18205]]
-** in-silico_annotation
+== Reaction(s) known to produce the compound ==
-***ec-number
+== Reaction(s) of unknown directionality ==
-** [[pantograph]]-[[athaliana]]
+* [[RXN-18204]]
-== Pathways associated ==
-* [[PWY-5290]]
-* [[PWY-6326]]
 == External links  ==
-{{#set: left end position=628}}
+{{#set: smiles=CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
-{{#set: transcription direction=NEGATIVE}}
+{{#set: inchi key=InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L}}
-{{#set: right end position=3163}}
+{{#set: common name=3-isopropyl-8-(methylthio)-2-oxooctanoate}}
-{{#set: centisome position=6.1604867    }}
+{{#set: molecular weight=246.278    }}
-{{#set: reaction associated=STRICTOSIDINE-SYNTHASE-RXN}}
+{{#set: consumed by=RXN-18205}}
-{{#set: pathway associated=PWY-5290|PWY-6326}}
+{{#set: consumed or produced by=RXN-18204}}