Difference between revisions of "PREGNENOLONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=NAD-BIOSYNTHESIS-III NAD-BIOSYNTHESIS-III] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAG...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=NAD-BIOSYNTHESIS-III NAD-BIOSYNTHESIS-III] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** NAD biosynthesis III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** nicotinamide adenine dinucleotide biosynthesis |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''1''' reaction(s) found |
− | == Reaction(s) | + | ** [[2.4.2.12-RXN]] |
− | + | == Reaction(s) not found == | |
+ | * '''1''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.1-RXN 2.7.7.1-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=NAD biosynthesis III}} | |
− | + | {{#set: common name=nicotinamide adenine dinucleotide biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=1}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:01, 10 January 2018
Contents
Pathway NAD-BIOSYNTHESIS-III
- taxonomic range:
- common name:
- NAD biosynthesis III
- Synonym(s):
- nicotinamide adenine dinucleotide biosynthesis
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found