Difference between revisions of "NICOTINAMIDE NUCLEOTIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * smiles: ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=YB...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_MG+2 TransportSeed_MG+2] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_MG+2 TransportSeed_MG+2] ==
* smiles:
+
* direction:
** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L
+
* common name:
+
** 3-(5'-methylthio)pentylmalate
+
* molecular weight:
+
** 248.293   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-(5'-methylthio)pentylmalic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXNQT-4171]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[MG+2]][e] '''=>''' 1.0 [[MG+2]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
* [[RXN-18204]]
+
** 1.0 Mg2+[e] '''=>''' 1.0 Mg2+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[manual]]:
 +
** [[added to manage seeds from extracellular to cytosol compartment]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237178 44237178]
+
{{#set: in pathway=}}
{{#set: smiles=CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
+
{{#set: reconstruction category=manual}}
{{#set: inchi key=InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L}}
+
{{#set: reconstruction source=added to manage seeds from extracellular to cytosol compartment}}
{{#set: common name=3-(5'-methylthio)pentylmalate}}
+
{{#set: molecular weight=248.293    }}
+
{{#set: common name=3-(5'-methylthio)pentylmalic acid}}
+
{{#set: consumed by=RXNQT-4171}}
+
{{#set: consumed or produced by=RXN-18204}}
+

Revision as of 16:39, 10 January 2018

Reaction TransportSeed_MG+2

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 Mg2+[e] => 1.0 Mg2+[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links