Difference between revisions of "Tiso gene 19966"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11612 == * left end position: ** 47 * transcription direction: ** POSITIVE * right end position: ** 2180 * centisome position: ** 0.6122981...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] == * smiles: ** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M |
− | * | + | * common name: |
− | ** | + | ** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate |
− | * | + | * molecular weight: |
− | ** | + | ** 477.444 |
* Synonym(s): | * Synonym(s): | ||
+ | ** glcNAc-1,6-anhMurNAc | ||
+ | ** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN0-5226]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[RXN0- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658409 90658409] |
− | {{#set: | + | * BIGG : anhgm |
− | {{#set: | + | {{#set: smiles=CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M}} |
− | {{#set: | + | {{#set: common name=N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate}} |
+ | {{#set: molecular weight=477.444 }} | ||
+ | {{#set: common name=glcNAc-1,6-anhMurNAc|N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid}} | ||
+ | {{#set: consumed by=RXN0-5226}} |
Revision as of 16:45, 10 January 2018
Contents
Metabolite CPD0-1081
- smiles:
- CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))
- inchi key:
- InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M
- common name:
- N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate
- molecular weight:
- 477.444
- Synonym(s):
- glcNAc-1,6-anhMurNAc
- N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- BIGG : anhgm
"CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))" cannot be used as a page name in this wiki.