Difference between revisions of "Tiso gene 19966"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_11612 == * left end position: ** 47 * transcription direction: ** POSITIVE * right end position: ** 2180 * centisome position: ** 0.6122981...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] == * smiles: ** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_11612 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] ==
−
* left end position:
+
* smiles:
−
** 47
+
** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M
−
* right end position:
+
* common name:
−
** 2180
+
** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate
−
* centisome position:
+
* molecular weight:
−
** 0.6122981    
+
** 477.444    
 
* Synonym(s):
 
* Synonym(s):
 +
** glcNAc-1,6-anhMurNAc
 +
** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.1.13.1-RXN]]
+
* [[RXN0-5226]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[RXN0-4222]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN0-6479]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN0-6524]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN0-6525]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY0-1479]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=47}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658409 90658409]
−
{{#set: right end position=2180}}
+
* BIGG : anhgm
−
{{#set: centisome position=0.6122981   }}
+
{{#set: smiles=CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))}}
−
{{#set: reaction associated=3.1.13.1-RXN|RXN0-4222|RXN0-6479|RXN0-6524|RXN0-6525}}
+
{{#set: inchi key=InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M}}
−
{{#set: pathway associated=PWY0-1479}}
+
{{#set: common name=N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate}}
 +
{{#set: molecular weight=477.444   }}
 +
{{#set: common name=glcNAc-1,6-anhMurNAc|N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid}}
 +
{{#set: consumed by=RXN0-5226}}

Revision as of 16:45, 10 January 2018

Metabolite CPD0-1081

  • smiles:
    • CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))
  • inchi key:
    • InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M
  • common name:
    • N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate
  • molecular weight:
    • 477.444
  • Synonym(s):
    • glcNAc-1,6-anhMurNAc
    • N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19966&oldid=14484"