Difference between revisions of "Cis-delta15-3-hydroxygheddoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == * smiles: ** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_12041 == * left end position: ** 5069 * transcription direction: ** POSITIVE * right end position: ** 7267 * centisome position: ** 69.0035...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12041 == |
− | * | + | * left end position: |
− | ** | + | ** 5069 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 7267 |
− | * | + | * centisome position: |
− | ** | + | ** 69.00354 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[DIAMINOPIMDECARB-RXN]] | |
− | == | + | ** in-silico_annotation |
− | * [[ | + | ***automated-name-match |
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5097]] | ||
+ | * [[PWY-2942]] | ||
+ | * [[DAPLYSINESYN-PWY]] | ||
+ | * [[PWY-2941]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5069}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: right end position=7267}} |
− | {{#set: | + | {{#set: centisome position=69.00354 }} |
− | {{#set: | + | {{#set: reaction associated=DIAMINOPIMDECARB-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-5097|PWY-2942|DAPLYSINESYN-PWY|PWY-2941}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:49, 10 January 2018
Gene Tiso_gene_12041
- left end position:
- 5069
- transcription direction:
- POSITIVE
- right end position:
- 7267
- centisome position:
- 69.00354
- Synonym(s):
Reactions associated
- DIAMINOPIMDECARB-RXN
- in-silico_annotation
- automated-name-match
- pantograph-athaliana
- pantograph-synechocystis
- pantograph-esiliculosus
- pantograph-creinhardtii
- in-silico_annotation