Difference between revisions of "DIHYDROSIROHYDROCHLORIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11592 CPD-11592] == * smiles: ** CC(C)=CCNC3(C2(N=CN(C1(OC(COP(=O)([O-])O[a tRNA])C(OP([O-]...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11592 CPD-11592] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)=CCNC3(C2(N=CN(C1(OC(COP(=O)([O-])O[a tRNA])C(OP([O-])(=O)O[a tRNA])C(O)1))C=2N=C(SC)N=3)) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-methylthio-N6-dimethylallyladenosine37 in tRNA |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** tRNA-(2-methylthio-N6-dimethylallyladenosine37) | ||
| + | ** a tRNA containing 2-methylthio-N6-dimethylallyladenosine37 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14481]] |
| + | * [[RXN0-5063]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: smiles= | + | * CHEBI: |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74417 74417] | |
| − | {{#set: common name= | + | {{#set: smiles=CC(C)=CCNC3(C2(N=CN(C1(OC(COP(=O)([O-])O[a tRNA])C(OP([O-])(=O)O[a tRNA])C(O)1))C=2N=C(SC)N=3))}} |
| − | {{#set: | + | {{#set: common name=2-methylthio-N6-dimethylallyladenosine37 in tRNA}} |
| − | {{#set: produced by=RXN- | + | {{#set: common name=tRNA-(2-methylthio-N6-dimethylallyladenosine37)|a tRNA containing 2-methylthio-N6-dimethylallyladenosine37}} |
| + | {{#set: produced by=RXN-14481|RXN0-5063}} | ||
Revision as of 17:09, 10 January 2018
Contents
Metabolite CPD-11592
- smiles:
- CC(C)=CCNC3(C2(N=CN(C1(OC(COP(=O)([O-])O[a tRNA])C(OP([O-])(=O)O[a tRNA])C(O)1))C=2N=C(SC)N=3))
- common name:
- 2-methylthio-N6-dimethylallyladenosine37 in tRNA
- Synonym(s):
- tRNA-(2-methylthio-N6-dimethylallyladenosine37)
- a tRNA containing 2-methylthio-N6-dimethylallyladenosine37
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEBI:
"CC(C)=CCNC3(C2(N=CN(C1(OC(COP(=O)([O-])O[a tRNA])C(OP([O-])(=O)O[a tRNA])C(O)1))C=2N=C(SC)N=3))" cannot be used as a page name in this wiki.
